C15H18N2O3S — CID 125482961
1-butyl-3-naphthalen-1-ylsulfonylurea (PubChem CID 125482961) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is 1-butyl-3-naphthalen-1-ylsulfonylurea.
| Compound Name | 1-butyl-3-naphthalen-1-ylsulfonylurea |
|---|---|
| PubChem CID | 125482961 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-butyl-3-naphthalen-1-ylsulfonylurea |
| SMILES | CCCCNC(=O)NS(=O)(=O)c1cccc2ccccc12 |
| InChI | InChI=1S/C15H18N2O3S/c1-2-3-11-16-15(18)17-21(19,20)14-10-6-8-12-7-4-5-9-13(12)14/h4-10H,2-3,11H2,1H3,(H2,16,17,18) |
| InChIKey | YBYHZYSLSDOXGN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|