C10H13IN2O3S — CID 18987809
1-(2-iodophenyl)sulfonyl-3-propylurea (PubChem CID 18987809) has the molecular formula C10H13IN2O3S and a molecular weight of 368.20 g/mol. Its IUPAC name is 1-(2-iodophenyl)sulfonyl-3-propylurea.
| Compound Name | 1-(2-iodophenyl)sulfonyl-3-propylurea |
|---|---|
| PubChem CID | 18987809 |
| Molecular Formula | C10H13IN2O3S |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 367.97 |
| IUPAC Name | 1-(2-iodophenyl)sulfonyl-3-propylurea |
| SMILES | CCCNC(=O)NS(=O)(=O)c1ccccc1I |
| InChI | InChI=1S/C10H13IN2O3S/c1-2-7-12-10(14)13-17(15,16)9-6-4-3-5-8(9)11/h3-6H,2,7H2,1H3,(H2,12,13,14) |
| InChIKey | HTBIQRDIDVSHCY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|