C12H14IN3O3S — CID 70880681
4-ethyl-N-(2-iodophenyl)sulfonyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 70880681) has the molecular formula C12H14IN3O3S and a molecular weight of 407.23 g/mol. Its IUPAC name is 4-ethyl-N-(2-iodophenyl)sulfonyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | 4-ethyl-N-(2-iodophenyl)sulfonyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 70880681 |
| Molecular Formula | C12H14IN3O3S |
| Molecular Weight | 407.23 g/mol |
| Exact Mass | 406.98 |
| IUPAC Name | 4-ethyl-N-(2-iodophenyl)sulfonyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | CCC1C=NN(C(=O)NS(=O)(=O)c2ccccc2I)C1 |
| InChI | InChI=1S/C12H14IN3O3S/c1-2-9-7-14-16(8-9)12(17)15-20(18,19)11-6-4-3-5-10(11)13/h3-7,9H,2,8H2,1H3,(H,15,17) |
| InChIKey | OODJZMNETSCCDL-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.23 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|