C17H14N4O3S — CID 68823873
N-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide (PubChem CID 68823873) has the molecular formula C17H14N4O3S and a molecular weight of 354.39 g/mol. Its IUPAC name is N-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide.
| Compound Name | N-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
|---|---|
| PubChem CID | 68823873 |
| Molecular Formula | C17H14N4O3S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | N-(4-cyanophenyl)sulfonyl-4-phenyl-3,4-dihydropyrazole-2-carboxamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NC(=O)N2CC(c3ccccc3)C=N2)cc1 |
| InChI | InChI=1S/C17H14N4O3S/c18-10-13-6-8-16(9-7-13)25(23,24)20-17(22)21-12-15(11-19-21)14-4-2-1-3-5-14/h1-9,11,15H,12H2,(H,20,22) |
| InChIKey | JMIXAHHDSJKZAO-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |