C16H14N2O4S — CID 3861560
methyl 2-[(4-cyanophenyl)sulfonylamino]-2-phenylacetate (PubChem CID 3861560) has the molecular formula C16H14N2O4S and a molecular weight of 330.37 g/mol. Its IUPAC name is methyl 2-[(4-cyanophenyl)sulfonylamino]-2-phenylacetate.
| Compound Name | methyl 2-[(4-cyanophenyl)sulfonylamino]-2-phenylacetate |
|---|---|
| PubChem CID | 3861560 |
| Molecular Formula | C16H14N2O4S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | methyl 2-[(4-cyanophenyl)sulfonylamino]-2-phenylacetate |
| SMILES | COC(=O)C(NS(=O)(=O)c1ccc(C#N)cc1)c1ccccc1 |
| InChI | InChI=1S/C16H14N2O4S/c1-22-16(19)15(13-5-3-2-4-6-13)18-23(20,21)14-9-7-12(11-17)8-10-14/h2-10,15,18H,1H3 |
| InChIKey | BTDDDZPNVPUAQT-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |