C31H27N3O4S — CID 135064690
methyl (2S,3S)-2-(benzhydrylideneamino)-3-(4-cyanophenyl)-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 135064690) has the molecular formula C31H27N3O4S and a molecular weight of 537.64 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzhydrylideneamino)-3-(4-cyanophenyl)-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S,3S)-2-(benzhydrylideneamino)-3-(4-cyanophenyl)-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 135064690 |
| Molecular Formula | C31H27N3O4S |
| Molecular Weight | 537.64 g/mol |
| Exact Mass | 537.17 |
| IUPAC Name | methyl (2S,3S)-2-(benzhydrylideneamino)-3-(4-cyanophenyl)-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C31H27N3O4S/c1-22-13-19-27(20-14-22)39(36,37)34-29(26-17-15-23(21-32)16-18-26)30(31(35)38-2)33-28(24-9-5-3-6-10-24)25-11-7-4-8-12-25/h3-20,29-30,34H,1-2H3/t29-,30-/m0/s1 |
| InChIKey | IEGNLMRHIFTLGT-KYJUHHDHSA-N |
| XLogP | 4.97 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.64 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|