C30H27N3O6S — CID 66554006
methyl (2S,3S)-2-(benzhydrylideneamino)-3-[(4-methylphenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate (PubChem CID 66554006) has the molecular formula C30H27N3O6S and a molecular weight of 557.63 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzhydrylideneamino)-3-[(4-methylphenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate.
| Compound Name | methyl (2S,3S)-2-(benzhydrylideneamino)-3-[(4-methylphenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 66554006 |
| Molecular Formula | C30H27N3O6S |
| Molecular Weight | 557.63 g/mol |
| Exact Mass | 557.16 |
| IUPAC Name | methyl (2S,3S)-2-(benzhydrylideneamino)-3-[(4-methylphenyl)sulfonylamino]-3-(3-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C30H27N3O6S/c1-21-16-18-26(19-17-21)40(37,38)32-28(24-14-9-15-25(20-24)33(35)36)29(30(34)39-2)31-27(22-10-5-3-6-11-22)23-12-7-4-8-13-23/h3-20,28-29,32H,1-2H3/t28-,29-/m0/s1 |
| InChIKey | NPXUJFMUNVYQCU-VMPREFPWSA-N |
| XLogP | 5.00 |
| TPSA | 127.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|