C30H34N2O4S — CID 10984145
methyl (2S,3R)-2-(benzhydrylideneamino)-3-cyclohexyl-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 10984145) has the molecular formula C30H34N2O4S and a molecular weight of 518.68 g/mol. Its IUPAC name is methyl (2S,3R)-2-(benzhydrylideneamino)-3-cyclohexyl-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2S,3R)-2-(benzhydrylideneamino)-3-cyclohexyl-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 10984145 |
| Molecular Formula | C30H34N2O4S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | methyl (2S,3R)-2-(benzhydrylideneamino)-3-cyclohexyl-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@@H](N=C(c1ccccc1)c1ccccc1)[C@H](NS(=O)(=O)c1ccc(C)cc1)C1CCCCC1 |
| InChI | InChI=1S/C30H34N2O4S/c1-22-18-20-26(21-19-22)37(34,35)32-28(25-16-10-5-11-17-25)29(30(33)36-2)31-27(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-4,6-9,12-15,18-21,25,28-29,32H,5,10-11,16-17H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | RWNBVDGURUNISO-WDYNHAJCSA-N |
| XLogP | 5.30 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|