C20H25NO2S — CID 11393771
N-[cyclohexyl-(4-methylphenyl)methyl]benzenesulfonamide (PubChem CID 11393771) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is N-[cyclohexyl-(4-methylphenyl)methyl]benzenesulfonamide.
| Compound Name | N-[cyclohexyl-(4-methylphenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 11393771 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | N-[cyclohexyl-(4-methylphenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(C(NS(=O)(=O)c2ccccc2)C2CCCCC2)cc1 |
| InChI | InChI=1S/C20H25NO2S/c1-16-12-14-18(15-13-16)20(17-8-4-2-5-9-17)21-24(22,23)19-10-6-3-7-11-19/h3,6-7,10-15,17,20-21H,2,4-5,8-9H2,1H3 |
| InChIKey | LOKYVUBGUBUQJX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |