C19H23NO3S — CID 101180255
4-methyl-N-[oxan-2-yl(phenyl)methyl]benzenesulfonamide (PubChem CID 101180255) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 4-methyl-N-[oxan-2-yl(phenyl)methyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[oxan-2-yl(phenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 101180255 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 4-methyl-N-[oxan-2-yl(phenyl)methyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2ccccc2)C2CCCCO2)cc1 |
| InChI | InChI=1S/C19H23NO3S/c1-15-10-12-17(13-11-15)24(21,22)20-19(16-7-3-2-4-8-16)18-9-5-6-14-23-18/h2-4,7-8,10-13,18-20H,5-6,9,14H2,1H3 |
| InChIKey | CGJKVMWEYAMBDI-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |