C24H27NO7S — CID 25179532
dimethyl 2-[[4-[[(4-methylphenyl)sulfonylamino]-(oxolan-2-yl)methyl]phenyl]methylidene]propanedioate (PubChem CID 25179532) has the molecular formula C24H27NO7S and a molecular weight of 473.55 g/mol. Its IUPAC name is dimethyl 2-[[4-[[(4-methylphenyl)sulfonylamino]-(oxolan-2-yl)methyl]phenyl]methylidene]propanedioate.
| Compound Name | dimethyl 2-[[4-[[(4-methylphenyl)sulfonylamino]-(oxolan-2-yl)methyl]phenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 25179532 |
| Molecular Formula | C24H27NO7S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.15 |
| IUPAC Name | dimethyl 2-[[4-[[(4-methylphenyl)sulfonylamino]-(oxolan-2-yl)methyl]phenyl]methylidene]propanedioate |
| SMILES | COC(=O)C(=Cc1ccc(C(NS(=O)(=O)c2ccc(C)cc2)C2CCCO2)cc1)C(=O)OC |
| InChI | InChI=1S/C24H27NO7S/c1-16-6-12-19(13-7-16)33(28,29)25-22(21-5-4-14-32-21)18-10-8-17(9-11-18)15-20(23(26)30-2)24(27)31-3/h6-13,15,21-22,25H,4-5,14H2,1-3H3 |
| InChIKey | SXCVWBRFKUBVSZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|