C15H23NO2S — CID 81393099
N-[(1R)-1-cycloheptylethyl]benzenesulfonamide (PubChem CID 81393099) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is N-[(1R)-1-cycloheptylethyl]benzenesulfonamide.
| Compound Name | N-[(1R)-1-cycloheptylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 81393099 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[(1R)-1-cycloheptylethyl]benzenesulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)c1ccccc1)C1CCCCCC1 |
| InChI | InChI=1S/C15H23NO2S/c1-13(14-9-5-2-3-6-10-14)16-19(17,18)15-11-7-4-8-12-15/h4,7-8,11-14,16H,2-3,5-6,9-10H2,1H3/t13-/m1/s1 |
| InChIKey | AYJPOGMBASIBQL-CYBMUJFWSA-N |
| XLogP | 3.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |