C19H26N2 — CID 79107738
N-[cyclohexyl(phenyl)methyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79107738) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-[cyclohexyl(phenyl)methyl]-2,5-dimethylpyrrol-1-amine.
| Compound Name | N-[cyclohexyl(phenyl)methyl]-2,5-dimethylpyrrol-1-amine |
|---|---|
| PubChem CID | 79107738 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-[cyclohexyl(phenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC(c1ccccc1)C1CCCCC1 |
| InChI | InChI=1S/C19H26N2/c1-15-13-14-16(2)21(15)20-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3,5-6,9-10,13-14,18-20H,4,7-8,11-12H2,1-2H3 |
| InChIKey | YSUVQPAJTYWTKN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |