C30H35ClN2O4S — CID 23584778
ethyl (2R,3S)-2-(benzhydrylideneamino)-4-chloro-4-ethyl-3-[(4-methylphenyl)sulfonylamino]hexanoate (PubChem CID 23584778) has the molecular formula C30H35ClN2O4S and a molecular weight of 555.14 g/mol. Its IUPAC name is ethyl (2R,3S)-2-(benzhydrylideneamino)-4-chloro-4-ethyl-3-[(4-methylphenyl)sulfonylamino]hexanoate.
| Compound Name | ethyl (2R,3S)-2-(benzhydrylideneamino)-4-chloro-4-ethyl-3-[(4-methylphenyl)sulfonylamino]hexanoate |
|---|---|
| PubChem CID | 23584778 |
| Molecular Formula | C30H35ClN2O4S |
| Molecular Weight | 555.14 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | ethyl (2R,3S)-2-(benzhydrylideneamino)-4-chloro-4-ethyl-3-[(4-methylphenyl)sulfonylamino]hexanoate |
| SMILES | CCOC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@H](NS(=O)(=O)c1ccc(C)cc1)C(Cl)(CC)CC |
| InChI | InChI=1S/C30H35ClN2O4S/c1-5-30(31,6-2)28(33-38(35,36)25-20-18-22(4)19-21-25)27(29(34)37-7-3)32-26(23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-21,27-28,33H,5-7H2,1-4H3/t27-,28+/m1/s1 |
| InChIKey | WPNFJZKWZCBWJY-IZLXSDGUSA-N |
| XLogP | 5.91 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.14 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|