C30H33ClN2O4S — CID 23584777
methyl (2R,3S)-2-(benzhydrylideneamino)-3-(1-chlorocyclohexyl)-3-[(4-methylphenyl)sulfonylamino]propanoate (PubChem CID 23584777) has the molecular formula C30H33ClN2O4S and a molecular weight of 553.12 g/mol. Its IUPAC name is methyl (2R,3S)-2-(benzhydrylideneamino)-3-(1-chlorocyclohexyl)-3-[(4-methylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(1-chlorocyclohexyl)-3-[(4-methylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 23584777 |
| Molecular Formula | C30H33ClN2O4S |
| Molecular Weight | 553.12 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | methyl (2R,3S)-2-(benzhydrylideneamino)-3-(1-chlorocyclohexyl)-3-[(4-methylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)[C@H](N=C(c1ccccc1)c1ccccc1)[C@H](NS(=O)(=O)c1ccc(C)cc1)C1(Cl)CCCCC1 |
| InChI | InChI=1S/C30H33ClN2O4S/c1-22-16-18-25(19-17-22)38(35,36)33-28(30(31)20-10-5-11-21-30)27(29(34)37-2)32-26(23-12-6-3-7-13-23)24-14-8-4-9-15-24/h3-4,6-9,12-19,27-28,33H,5,10-11,20-21H2,1-2H3/t27-,28+/m1/s1 |
| InChIKey | UQNBKZSZMPIHJR-IZLXSDGUSA-N |
| XLogP | 5.66 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.12 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|