C36H34N2O2S — CID 155931491
N-[2-(benzhydrylideneamino)-1,2-bis(3-methylphenyl)ethyl]-4-methylbenzenesulfonamide (PubChem CID 155931491) has the molecular formula C36H34N2O2S and a molecular weight of 558.75 g/mol. Its IUPAC name is N-[2-(benzhydrylideneamino)-1,2-bis(3-methylphenyl)ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-(benzhydrylideneamino)-1,2-bis(3-methylphenyl)ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 155931491 |
| Molecular Formula | C36H34N2O2S |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | N-[2-(benzhydrylideneamino)-1,2-bis(3-methylphenyl)ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(c2cccc(C)c2)C(N=C(c2ccccc2)c2ccccc2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C36H34N2O2S/c1-26-20-22-33(23-21-26)41(39,40)38-36(32-19-11-13-28(3)25-32)35(31-18-10-12-27(2)24-31)37-34(29-14-6-4-7-15-29)30-16-8-5-9-17-30/h4-25,35-36,38H,1-3H3 |
| InChIKey | YOJHJBMQGPCUAE-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|