C22H20BrNO3S — CID 102280789
N-[(1R,2R)-2-bromo-3-oxo-1,3-diphenylpropyl]-4-methylbenzenesulfonamide (PubChem CID 102280789) has the molecular formula C22H20BrNO3S and a molecular weight of 458.38 g/mol. Its IUPAC name is N-[(1R,2R)-2-bromo-3-oxo-1,3-diphenylpropyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-bromo-3-oxo-1,3-diphenylpropyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 102280789 |
| Molecular Formula | C22H20BrNO3S |
| Molecular Weight | 458.38 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | N-[(1R,2R)-2-bromo-3-oxo-1,3-diphenylpropyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](c2ccccc2)[C@@H](Br)C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H20BrNO3S/c1-16-12-14-19(15-13-16)28(26,27)24-21(17-8-4-2-5-9-17)20(23)22(25)18-10-6-3-7-11-18/h2-15,20-21,24H,1H3/t20-,21-/m1/s1 |
| InChIKey | MNXLAJPTLRUVCE-NHCUHLMSSA-N |
| XLogP | 4.66 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|