C23H24NO3S2+ — CID 10788532
[1-(benzenesulfonamido)-3-oxo-1,3-diphenylpropan-2-yl]-dimethylsulfanium (PubChem CID 10788532) has the molecular formula C23H24NO3S2+ and a molecular weight of 426.58 g/mol. Its IUPAC name is [1-(benzenesulfonamido)-3-oxo-1,3-diphenylpropan-2-yl]-dimethylsulfanium.
| Compound Name | [1-(benzenesulfonamido)-3-oxo-1,3-diphenylpropan-2-yl]-dimethylsulfanium |
|---|---|
| PubChem CID | 10788532 |
| Molecular Formula | C23H24NO3S2+ |
| Molecular Weight | 426.58 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | [1-(benzenesulfonamido)-3-oxo-1,3-diphenylpropan-2-yl]-dimethylsulfanium |
| SMILES | C[S+](C)C(C(=O)c1ccccc1)C(NS(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24NO3S2/c1-28(2)23(22(25)19-14-8-4-9-15-19)21(18-12-6-3-7-13-18)24-29(26,27)20-16-10-5-11-17-20/h3-17,21,23-24H,1-2H3/q+1 |
| InChIKey | APGGKQWTRCMDGE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.58 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|