C23H23NO3S2 — CID 10788531
benzenesulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide (PubChem CID 10788531) has the molecular formula C23H23NO3S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is benzenesulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide.
| Compound Name | benzenesulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide |
|---|---|
| PubChem CID | 10788531 |
| Molecular Formula | C23H23NO3S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | benzenesulfonyl-(2-dimethylsulfonio-3-oxo-1,3-diphenylpropyl)azanide |
| SMILES | C[S+](C)C(C(=O)c1ccccc1)C([N-]S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H23NO3S2/c1-28(2)23(22(25)19-14-8-4-9-15-19)21(18-12-6-3-7-13-18)24-29(26,27)20-16-10-5-11-17-20/h3-17,21,23H,1-2H3 |
| InChIKey | SYGOYEFFKHNIHV-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 65.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|