C33H38N2O2RuS — CID 11157905
[(1R,2R)-2-azanidyl-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;1,2,3,4,5,6-hexamethylbenzene;ruthenium(2+) (PubChem CID 11157905) has the molecular formula C33H38N2O2RuS and a molecular weight of 627.82 g/mol. Its IUPAC name is [(1R,2R)-2-azanidyl-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;1,2,3,4,5,6-hexamethylbenzene;ruthenium(2+).
| Compound Name | [(1R,2R)-2-azanidyl-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;1,2,3,4,5,6-hexamethylbenzene;ruthenium(2+) |
|---|---|
| PubChem CID | 11157905 |
| Molecular Formula | C33H38N2O2RuS |
| Molecular Weight | 627.82 g/mol |
| Exact Mass | 628.17 |
| IUPAC Name | [(1R,2R)-2-azanidyl-1,2-diphenylethyl]-(4-methylphenyl)sulfonylazanide;1,2,3,4,5,6-hexamethylbenzene;ruthenium(2+) |
| SMILES | Cc1c(C)c(C)c(C)c(C)c1C.Cc1ccc(S(=O)(=O)[N-][C@H](c2ccccc2)[C@H]([NH-])c2ccccc2)cc1.[Ru+2] |
| InChI | InChI=1S/C21H20N2O2S.C12H18.Ru/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17;1-7-8(2)10(4)12(6)11(5)9(7)3;/h2-15,20-22H,1H3;1-6H3;/q-2;;+2/t20-,21-;;/m1../s1 |
| InChIKey | MOXFNVMWTBYYEC-OXIQQVKJSA-N |
| XLogP | 9.13 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.82 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |