C31H33ClN2O2RuS — CID 176507833
CID 176507833 (PubChem CID 176507833) has the molecular formula C31H33ClN2O2RuS and a molecular weight of 634.21 g/mol.
| Compound Name | CID 176507833 |
|---|---|
| PubChem CID | 176507833 |
| Molecular Formula | C31H33ClN2O2RuS |
| Molecular Weight | 634.21 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(C)C)cc1.Cc1ccc(S(=O)(=O)[N-][C@H](c2ccccc2)[C@H]([N-])c2ccccc2)cc1.Cl[Ru+2] |
| InChI | InChI=1S/C21H19N2O2S.C10H14.ClH.Ru/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17;1-8(2)10-6-4-9(3)5-7-10;;/h2-15,20-21H,1H3;4-8H,1-3H3;1H;/q-2;;;+3/p-1/t20-,21-;;;/m1.../s1 |
| InChIKey | NAUYFYZHGMXHMY-AGEKDOICSA-M |
| XLogP | 9.18 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.21 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |