About CID 176507833
CID 176507833 (PubChem CID 176507833) has the molecular formula C31H33ClN2O2RuS
and a molecular weight of 634.21 g/mol.
Molecular Properties
| Compound Name | CID 176507833 |
| PubChem CID | 176507833 |
| Molecular Formula | C31H33ClN2O2RuS |
| Molecular Weight | 634.21 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | — |
| SMILES | Cc1ccc(C(C)C)cc1.Cc1ccc(S(=O)(=O)[N-][C@H](c2ccccc2)[C@H]([N-])c2ccccc2)cc1.Cl[Ru+2] |
| InChI | InChI=1S/C21H19N2O2S.C10H14.ClH.Ru/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17;1-8(2)10-6-4-9(3)5-7-10;;/h2-15,20-21H,1H3;4-8H,1-3H3;1H;/q-2;;;+3/p-1/t20-,21-;;;/m1.../s1 |
| InChIKey | NAUYFYZHGMXHMY-AGEKDOICSA-M |
| XLogP | 9.18 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 634.21 |
| LogP ≤ 5 | 9.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 176507833 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 176507833?
The IUPAC name of CID 176507833 (CID 176507833) is not available.
What is the SMILES notation for CID 176507833?
The canonical SMILES for CID 176507833 is Cc1ccc(C(C)C)cc1.Cc1ccc(S(=O)(=O)[N-][C@H](c2ccccc2)[C@H]([N-])c2ccccc2)cc1.Cl[Ru+2].
What is the InChIKey of CID 176507833?
The InChIKey is NAUYFYZHGMXHMY-AGEKDOICSA-M. The full InChI is InChI=1S/C21H19N2O2S.C10H14.ClH.Ru/c1-16-12-14-19(15-13-16)26(24,25)23-21(18-10-6-3-7-11-18)20(22)17-8-4-2-5-9-17;1-8(2)10-6-4-9(3)5-7-10;;/h2-15,20-21H,1H3;4-8H,1-3H3;1H;/q-2;;;+3/p-1/t20-,21-;;;/m1.../s1.
What are the key properties of CID 176507833?
CID 176507833 has a molecular weight of 634.21 g/mol, XLogP of 9.18, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 176507833 is sourced from PubChem (CID 176507833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).