C30H28ClF5N2O2RuS+ — CID 170923621
[(1R,2R)-2-amino-1,2-diphenylethyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene (PubChem CID 170923621) has the molecular formula C30H28ClF5N2O2RuS+ and a molecular weight of 712.15 g/mol. Its IUPAC name is [(1R,2R)-2-amino-1,2-diphenylethyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene.
| Compound Name | [(1R,2R)-2-amino-1,2-diphenylethyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene |
|---|---|
| PubChem CID | 170923621 |
| Molecular Formula | C30H28ClF5N2O2RuS+ |
| Molecular Weight | 712.15 g/mol |
| Exact Mass | 712.05 |
| IUPAC Name | [(1R,2R)-2-amino-1,2-diphenylethyl]-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide;chlororuthenium(2+);1-methyl-4-propan-2-ylbenzene |
| SMILES | Cc1ccc(C(C)C)cc1.Cl[Ru+2].N[C@H](c1ccccc1)[C@H]([N-]S(=O)(=O)c1c(F)c(F)c(F)c(F)c1F)c1ccccc1 |
| InChI | InChI=1S/C20H14F5N2O2S.C10H14.ClH.Ru/c21-13-14(22)16(24)20(17(25)15(13)23)30(28,29)27-19(12-9-5-2-6-10-12)18(26)11-7-3-1-4-8-11;1-8(2)10-6-4-9(3)5-7-10;;/h1-10,18-19H,26H2;4-8H,1-3H3;1H;/q-1;;;+3/p-1/t18-,19-;;;/m1.../s1 |
| InChIKey | GEJRWMHZSKMITQ-ZJPTYAPPSA-M |
| XLogP | 8.69 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.15 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|