C25H31IrN2O2S+ — CID 24808888
CID 24808888 (PubChem CID 24808888) has the molecular formula C25H31IrN2O2S+ and a molecular weight of 615.82 g/mol.
| Compound Name | CID 24808888 |
|---|---|
| PubChem CID | 24808888 |
| Molecular Formula | C25H31IrN2O2S+ |
| Molecular Weight | 615.82 g/mol |
| Exact Mass | 616.17 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)[N-][C@@H](c1ccccc1)[C@@H]([NH-])c1ccccc1.C[C]1[C](C)[C](C)[C](C)[C]1C.[Ir+3] |
| InChI | InChI=1S/C15H16N2O2S.C10H15.Ir/c1-20(18,19)17-15(13-10-6-3-7-11-13)14(16)12-8-4-2-5-9-12;1-6-7(2)9(4)10(5)8(6)3;/h2-11,14-16H,1H3;1-5H3;/q-2;;+3/t14-,15-;;/m0../s1 |
| InChIKey | HDKLYIUTZIJGPN-WVFPUEBHSA-N |
| XLogP | 6.82 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.82 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |