C28H35ClN2O2RuS — CID 59537641
(2-azanidyl-1,2-diphenylethyl)-[[2,6-di(propan-2-yl)phenyl]methylsulfonyl]azanide;carbanide;chlororuthenium(3+) (PubChem CID 59537641) has the molecular formula C28H35ClN2O2RuS and a molecular weight of 600.19 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)-[[2,6-di(propan-2-yl)phenyl]methylsulfonyl]azanide;carbanide;chlororuthenium(3+).
| Compound Name | (2-azanidyl-1,2-diphenylethyl)-[[2,6-di(propan-2-yl)phenyl]methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 59537641 |
| Molecular Formula | C28H35ClN2O2RuS |
| Molecular Weight | 600.19 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)-[[2,6-di(propan-2-yl)phenyl]methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
| SMILES | CC(C)c1cccc(C(C)C)c1CS(=O)(=O)[N-]C(c1ccccc1)C([NH-])c1ccccc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C27H32N2O2S.CH3.ClH.Ru/c1-19(2)23-16-11-17-24(20(3)4)25(23)18-32(30,31)29-27(22-14-9-6-10-15-22)26(28)21-12-7-5-8-13-21;;;/h5-17,19-20,26-28H,18H2,1-4H3;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | SMPKHXLMRCJZST-UHFFFAOYSA-M |
| XLogP | 8.81 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.19 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|