C27H33ClN2O2RuS — CID 59537294
(2-azanidyl-1,2-diphenylethyl)-[(2,3,4,5,6-pentamethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) (PubChem CID 59537294) has the molecular formula C27H33ClN2O2RuS and a molecular weight of 586.16 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)-[(2,3,4,5,6-pentamethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+).
| Compound Name | (2-azanidyl-1,2-diphenylethyl)-[(2,3,4,5,6-pentamethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 59537294 |
| Molecular Formula | C27H33ClN2O2RuS |
| Molecular Weight | 586.16 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)-[(2,3,4,5,6-pentamethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
| SMILES | Cc1c(C)c(C)c(CS(=O)(=O)[N-]C(c2ccccc2)C([NH-])c2ccccc2)c(C)c1C.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C26H30N2O2S.CH3.ClH.Ru/c1-17-18(2)20(4)24(21(5)19(17)3)16-31(29,30)28-26(23-14-10-7-11-15-23)25(27)22-12-8-6-9-13-22;;;/h6-15,25-27H,16H2,1-5H3;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | HUPPTEPQOMDZMS-UHFFFAOYSA-M |
| XLogP | 8.10 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.16 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|