C26H31ClN2O2RuS — CID 59537461
(2-azanidyl-1,2-diphenylethyl)-[(2,4-diethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) (PubChem CID 59537461) has the molecular formula C26H31ClN2O2RuS and a molecular weight of 572.14 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)-[(2,4-diethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+).
| Compound Name | (2-azanidyl-1,2-diphenylethyl)-[(2,4-diethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 59537461 |
| Molecular Formula | C26H31ClN2O2RuS |
| Molecular Weight | 572.14 g/mol |
| Exact Mass | 572.08 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)-[(2,4-diethylphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
| SMILES | CCc1ccc(CS(=O)(=O)[N-]C(c2ccccc2)C([NH-])c2ccccc2)c(CC)c1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C25H28N2O2S.CH3.ClH.Ru/c1-3-19-15-16-23(20(4-2)17-19)18-30(28,29)27-25(22-13-9-6-10-14-22)24(26)21-11-7-5-8-12-21;;;/h5-17,24-26H,3-4,18H2,1-2H3;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | LWBLFDPKVMQMBC-UHFFFAOYSA-M |
| XLogP | 7.69 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.14 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|