C24H27ClN2O2RuS — CID 170545426
[(2S)-2-azanidyl-1,2-diphenylethyl]-(2,4,6-trimethylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) (PubChem CID 170545426) has the molecular formula C24H27ClN2O2RuS and a molecular weight of 544.08 g/mol. Its IUPAC name is [(2S)-2-azanidyl-1,2-diphenylethyl]-(2,4,6-trimethylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+).
| Compound Name | [(2S)-2-azanidyl-1,2-diphenylethyl]-(2,4,6-trimethylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 170545426 |
| Molecular Formula | C24H27ClN2O2RuS |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 544.05 |
| IUPAC Name | [(2S)-2-azanidyl-1,2-diphenylethyl]-(2,4,6-trimethylphenyl)sulfonylazanide;carbanide;chlororuthenium(3+) |
| SMILES | Cc1cc(C)c(S(=O)(=O)[N-]C(c2ccccc2)[C@@H]([NH-])c2ccccc2)c(C)c1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C23H24N2O2S.CH3.ClH.Ru/c1-16-14-17(2)23(18(3)15-16)28(26,27)25-22(20-12-8-5-9-13-20)21(24)19-10-6-4-7-11-19;;;/h4-15,21-22,24H,1-3H3;1H3;1H;/q-2;-1;;+4/p-1/t21-,22?;;;/m0.../s1 |
| InChIKey | CSGAVMJJAXEVJZ-FRXHHECKSA-M |
| XLogP | 7.35 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|