C23H25ClN2O3RuS — CID 59537286
(2-azanidyl-1,2-diphenylethyl)-[(4-methoxyphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) (PubChem CID 59537286) has the molecular formula C23H25ClN2O3RuS and a molecular weight of 546.05 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)-[(4-methoxyphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+).
| Compound Name | (2-azanidyl-1,2-diphenylethyl)-[(4-methoxyphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 59537286 |
| Molecular Formula | C23H25ClN2O3RuS |
| Molecular Weight | 546.05 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)-[(4-methoxyphenyl)methylsulfonyl]azanide;carbanide;chlororuthenium(3+) |
| SMILES | COc1ccc(CS(=O)(=O)[N-]C(c2ccccc2)C([NH-])c2ccccc2)cc1.Cl[Ru+3].[CH3-] |
| InChI | InChI=1S/C22H22N2O3S.CH3.ClH.Ru/c1-27-20-14-12-17(13-15-20)16-28(25,26)24-22(19-10-6-3-7-11-19)21(23)18-8-4-2-5-9-18;;;/h2-15,21-23H,16H2,1H3;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | ZFNJSXABBFKPRJ-UHFFFAOYSA-M |
| XLogP | 6.57 |
| TPSA | 81.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.05 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|