C32H34ClFN2O2RuS — CID 163962122
(2-azanidyl-1,2-diphenylethyl)-[(3-fluorophenyl)methylsulfonyl]azanide;chlororuthenium(3+);1,3,5,7-tetramethylcyclohepta-1,3,5-triene (PubChem CID 163962122) has the molecular formula C32H34ClFN2O2RuS and a molecular weight of 666.22 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)-[(3-fluorophenyl)methylsulfonyl]azanide;chlororuthenium(3+);1,3,5,7-tetramethylcyclohepta-1,3,5-triene.
| Compound Name | (2-azanidyl-1,2-diphenylethyl)-[(3-fluorophenyl)methylsulfonyl]azanide;chlororuthenium(3+);1,3,5,7-tetramethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 163962122 |
| Molecular Formula | C32H34ClFN2O2RuS |
| Molecular Weight | 666.22 g/mol |
| Exact Mass | 666.11 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)-[(3-fluorophenyl)methylsulfonyl]azanide;chlororuthenium(3+);1,3,5,7-tetramethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC(C)=C[C-](C)C(C)=C1.Cl[Ru+3].[NH-]C(c1ccccc1)C([N-]S(=O)(=O)Cc1cccc(F)c1)c1ccccc1 |
| InChI | InChI=1S/C21H19FN2O2S.C11H15.ClH.Ru/c22-19-13-7-8-16(14-19)15-27(25,26)24-21(18-11-5-2-6-12-18)20(23)17-9-3-1-4-10-17;1-8-5-9(2)7-11(4)10(3)6-8;;/h1-14,20-21,23H,15H2;5-7H,1-4H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | UYIZVVLVFNJJIK-UHFFFAOYSA-M |
| XLogP | 9.68 |
| TPSA | 72.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.22 |
| LogP ≤ 5 | 9.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|