C15H17ClN2Ru — CID 20778720
(2-azanidyl-1,2-diphenylethyl)azanide;carbanide;chlororuthenium(3+) (PubChem CID 20778720) has the molecular formula C15H17ClN2Ru and a molecular weight of 361.84 g/mol. Its IUPAC name is (2-azanidyl-1,2-diphenylethyl)azanide;carbanide;chlororuthenium(3+).
| Compound Name | (2-azanidyl-1,2-diphenylethyl)azanide;carbanide;chlororuthenium(3+) |
|---|---|
| PubChem CID | 20778720 |
| Molecular Formula | C15H17ClN2Ru |
| Molecular Weight | 361.84 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | (2-azanidyl-1,2-diphenylethyl)azanide;carbanide;chlororuthenium(3+) |
| SMILES | Cl[Ru+3].[CH3-].[NH-]C(c1ccccc1)C([NH-])c1ccccc1 |
| InChI | InChI=1S/C14H14N2.CH3.ClH.Ru/c15-13(11-7-3-1-4-8-11)14(16)12-9-5-2-6-10-12;;;/h1-10,13-16H;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | MQJVWBRUIQKMHD-UHFFFAOYSA-M |
| XLogP | 5.71 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.84 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|