About (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+)
(2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) (PubChem CID 58754581) has the molecular formula C7H9ClN2Ru
and a molecular weight of 257.69 g/mol. Its IUPAC name is (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+).
Molecular Properties
| Compound Name | (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) |
| PubChem CID | 58754581 |
| Molecular Formula | C7H9ClN2Ru |
| Molecular Weight | 257.69 g/mol |
| Exact Mass | 257.95 |
| IUPAC Name | (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) |
| SMILES | Cl[Ru+3].[CH3-].[NH-]c1ccccc1[NH-] |
| InChI | InChI=1S/C6H6N2.CH3.ClH.Ru/c7-5-3-1-2-4-6(5)8;;;/h1-4,7-8H;1H3;1H;/q-2;-1;;+4/p-1 |
| InChIKey | AFFNIMXHVDNWKJ-UHFFFAOYSA-M |
| XLogP | 4.19 |
| TPSA | 47.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.69 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+)?
The IUPAC name of (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) (CID 58754581) is (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+).
What is the SMILES notation for (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+)?
The canonical SMILES for (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) is Cl[Ru+3].[CH3-].[NH-]c1ccccc1[NH-].
What is the InChIKey of (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+)?
The InChIKey is AFFNIMXHVDNWKJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H6N2.CH3.ClH.Ru/c7-5-3-1-2-4-6(5)8;;;/h1-4,7-8H;1H3;1H;/q-2;-1;;+4/p-1.
What are the key properties of (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+)?
(2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) has a molecular weight of 257.69 g/mol, XLogP of 4.19, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-azanidylphenyl)azanide;carbanide;chlororuthenium(3+) is sourced from PubChem (CID 58754581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).