About (2-bromophenyl)azanide;yttrium
(2-bromophenyl)azanide;yttrium (PubChem CID 176967100) has the molecular formula C6H5BrNY-
and a molecular weight of 259.92 g/mol. Its IUPAC name is (2-bromophenyl)azanide;yttrium.
Molecular Properties
| Compound Name | (2-bromophenyl)azanide;yttrium |
| PubChem CID | 176967100 |
| Molecular Formula | C6H5BrNY- |
| Molecular Weight | 259.92 g/mol |
| Exact Mass | 258.87 |
| IUPAC Name | (2-bromophenyl)azanide;yttrium |
| SMILES | [NH-]c1ccccc1Br.[Y] |
| InChI | InChI=1S/C6H5BrN.Y/c7-5-3-1-2-4-6(5)8;/h1-4,8H;/q-1; |
| InChIKey | VRHOIAAMLJRCFT-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 23.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.92 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (2-bromophenyl)azanide;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-bromophenyl)azanide;yttrium?
The IUPAC name of (2-bromophenyl)azanide;yttrium (CID 176967100) is (2-bromophenyl)azanide;yttrium.
What is the SMILES notation for (2-bromophenyl)azanide;yttrium?
The canonical SMILES for (2-bromophenyl)azanide;yttrium is [NH-]c1ccccc1Br.[Y].
What is the InChIKey of (2-bromophenyl)azanide;yttrium?
The InChIKey is VRHOIAAMLJRCFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN.Y/c7-5-3-1-2-4-6(5)8;/h1-4,8H;/q-1;.
What are the key properties of (2-bromophenyl)azanide;yttrium?
(2-bromophenyl)azanide;yttrium has a molecular weight of 259.92 g/mol, XLogP of 3.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-bromophenyl)azanide;yttrium is sourced from PubChem (CID 176967100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).