About azane;1-bromo-2-iodobenzene
azane;1-bromo-2-iodobenzene (PubChem CID 139491171) has the molecular formula C6H7BrIN
and a molecular weight of 299.94 g/mol. Its IUPAC name is azane;1-bromo-2-iodobenzene.
Molecular Properties
| Compound Name | azane;1-bromo-2-iodobenzene |
| PubChem CID | 139491171 |
| Molecular Formula | C6H7BrIN |
| Molecular Weight | 299.94 g/mol |
| Exact Mass | 298.88 |
| IUPAC Name | azane;1-bromo-2-iodobenzene |
| SMILES | Brc1ccccc1I.N |
| InChI | InChI=1S/C6H4BrI.H3N/c7-5-3-1-2-4-6(5)8;/h1-4H;1H3 |
| InChIKey | PADFKDXNFZFREM-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.94 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze azane;1-bromo-2-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-bromo-2-iodobenzene?
The IUPAC name of azane;1-bromo-2-iodobenzene (CID 139491171) is azane;1-bromo-2-iodobenzene.
What is the SMILES notation for azane;1-bromo-2-iodobenzene?
The canonical SMILES for azane;1-bromo-2-iodobenzene is Brc1ccccc1I.N.
What is the InChIKey of azane;1-bromo-2-iodobenzene?
The InChIKey is PADFKDXNFZFREM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrI.H3N/c7-5-3-1-2-4-6(5)8;/h1-4H;1H3.
What are the key properties of azane;1-bromo-2-iodobenzene?
azane;1-bromo-2-iodobenzene has a molecular weight of 299.94 g/mol, XLogP of 3.22, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-bromo-2-iodobenzene is sourced from PubChem (CID 139491171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).