About 1-bromo-2-iodobenzene;molecular nitrogen
1-bromo-2-iodobenzene;molecular nitrogen (PubChem CID 155706234) has the molecular formula C6H4BrIN2
and a molecular weight of 310.92 g/mol. Its IUPAC name is 1-bromo-2-iodobenzene;molecular nitrogen.
Molecular Properties
| Compound Name | 1-bromo-2-iodobenzene;molecular nitrogen |
| PubChem CID | 155706234 |
| Molecular Formula | C6H4BrIN2 |
| Molecular Weight | 310.92 g/mol |
| Exact Mass | 309.86 |
| IUPAC Name | 1-bromo-2-iodobenzene;molecular nitrogen |
| SMILES | Brc1ccccc1I.N#N |
| InChI | InChI=1S/C6H4BrI.N2/c7-5-3-1-2-4-6(5)8;1-2/h1-4H; |
| InChIKey | MTKNNBAHWJXKQZ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.92 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-2-iodobenzene;molecular nitrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-iodobenzene;molecular nitrogen?
The IUPAC name of 1-bromo-2-iodobenzene;molecular nitrogen (CID 155706234) is 1-bromo-2-iodobenzene;molecular nitrogen.
What is the SMILES notation for 1-bromo-2-iodobenzene;molecular nitrogen?
The canonical SMILES for 1-bromo-2-iodobenzene;molecular nitrogen is Brc1ccccc1I.N#N.
What is the InChIKey of 1-bromo-2-iodobenzene;molecular nitrogen?
The InChIKey is MTKNNBAHWJXKQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrI.N2/c7-5-3-1-2-4-6(5)8;1-2/h1-4H;.
What are the key properties of 1-bromo-2-iodobenzene;molecular nitrogen?
1-bromo-2-iodobenzene;molecular nitrogen has a molecular weight of 310.92 g/mol, XLogP of 3.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-iodobenzene;molecular nitrogen is sourced from PubChem (CID 155706234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).