C51H36Br2Cl2I2O3 — CID 160658422
(1E,4E)-1,5-bis(2-bromophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-chlorophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-iodophenyl)penta-1,4-dien-3-one (PubChem CID 160658422) has the molecular formula C51H36Br2Cl2I2O3 and a molecular weight of 1181.37 g/mol. Its IUPAC name is (1E,4E)-1,5-bis(2-bromophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-chlorophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-iodophenyl)penta-1,4-dien-3-one.
| Compound Name | (1E,4E)-1,5-bis(2-bromophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-chlorophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-iodophenyl)penta-1,4-dien-3-one |
|---|---|
| PubChem CID | 160658422 |
| Molecular Formula | C51H36Br2Cl2I2O3 |
| Molecular Weight | 1181.37 g/mol |
| Exact Mass | 1177.85 |
| IUPAC Name | (1E,4E)-1,5-bis(2-bromophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-chlorophenyl)penta-1,4-dien-3-one;(1E,4E)-1,5-bis(2-iodophenyl)penta-1,4-dien-3-one |
| SMILES | O=C(/C=C/c1ccccc1Br)/C=C/c1ccccc1Br.O=C(/C=C/c1ccccc1Cl)/C=C/c1ccccc1Cl.O=C(/C=C/c1ccccc1I)/C=C/c1ccccc1I |
| InChI | InChI=1S/C17H12Br2O.C17H12Cl2O.C17H12I2O/c3*18-16-7-3-1-5-13(16)9-11-15(20)12-10-14-6-2-4-8-17(14)19/h3*1-12H/b3*11-9+,12-10+ |
| InChIKey | RLIVDOTXXNGUQU-DJBQSWAASA-N |
| XLogP | 15.99 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1181.37 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|