C15H9Cl3O — CID 7947559
(E)-3-(2-chlorophenyl)-1-(2,5-dichlorophenyl)prop-2-en-1-one (PubChem CID 7947559) has the molecular formula C15H9Cl3O and a molecular weight of 311.60 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-(2,5-dichlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-(2,5-dichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 7947559 |
| Molecular Formula | C15H9Cl3O |
| Molecular Weight | 311.60 g/mol |
| Exact Mass | 309.97 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-(2,5-dichlorophenyl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H9Cl3O/c16-11-6-7-14(18)12(9-11)15(19)8-5-10-3-1-2-4-13(10)17/h1-9H/b8-5+ |
| InChIKey | NSPVYYOXLHKNCE-VMPITWQZSA-N |
| XLogP | 5.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|