C9H6Cl2O2 — CID 23719435
1-(2,5-dichlorophenyl)-3-hydroxyprop-2-en-1-one (PubChem CID 23719435) has the molecular formula C9H6Cl2O2 and a molecular weight of 217.05 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)-3-hydroxyprop-2-en-1-one.
| Compound Name | 1-(2,5-dichlorophenyl)-3-hydroxyprop-2-en-1-one |
|---|---|
| PubChem CID | 23719435 |
| Molecular Formula | C9H6Cl2O2 |
| Molecular Weight | 217.05 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 1-(2,5-dichlorophenyl)-3-hydroxyprop-2-en-1-one |
| SMILES | O=C(C=CO)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H6Cl2O2/c10-6-1-2-8(11)7(5-6)9(13)3-4-12/h1-5,12H |
| InChIKey | YCHLPJLNRQNFRU-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.05 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_D(5)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|