C10H12Cl2O — CID 145081107
1-(2,5-dichlorophenyl)ethanone;ethane (PubChem CID 145081107) has the molecular formula C10H12Cl2O and a molecular weight of 219.11 g/mol. Its IUPAC name is 1-(2,5-dichlorophenyl)ethanone;ethane.
| Compound Name | 1-(2,5-dichlorophenyl)ethanone;ethane |
|---|---|
| PubChem CID | 145081107 |
| Molecular Formula | C10H12Cl2O |
| Molecular Weight | 219.11 g/mol |
| Exact Mass | 218.03 |
| IUPAC Name | 1-(2,5-dichlorophenyl)ethanone;ethane |
| SMILES | CC.CC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C8H6Cl2O.C2H6/c1-5(11)7-4-6(9)2-3-8(7)10;1-2/h2-4H,1H3;1-2H3 |
| InChIKey | JZVNBJJXHGWGLF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.11 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |