C14H9Cl3O — CID 82783018
1-[2-chloro-4-(2,4-dichlorophenyl)phenyl]ethanone (PubChem CID 82783018) has the molecular formula C14H9Cl3O and a molecular weight of 299.58 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,4-dichlorophenyl)phenyl]ethanone.
| Compound Name | 1-[2-chloro-4-(2,4-dichlorophenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 82783018 |
| Molecular Formula | C14H9Cl3O |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 297.97 |
| IUPAC Name | 1-[2-chloro-4-(2,4-dichlorophenyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C14H9Cl3O/c1-8(18)11-4-2-9(6-13(11)16)12-5-3-10(15)7-14(12)17/h2-7H,1H3 |
| InChIKey | RITCAQJAUQSVOM-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |