C16H15ClO — CID 82769802
1-[2-chloro-4-(2,3-dimethylphenyl)phenyl]ethanone (PubChem CID 82769802) has the molecular formula C16H15ClO and a molecular weight of 258.75 g/mol. Its IUPAC name is 1-[2-chloro-4-(2,3-dimethylphenyl)phenyl]ethanone.
| Compound Name | 1-[2-chloro-4-(2,3-dimethylphenyl)phenyl]ethanone |
|---|---|
| PubChem CID | 82769802 |
| Molecular Formula | C16H15ClO |
| Molecular Weight | 258.75 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-[2-chloro-4-(2,3-dimethylphenyl)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(-c2cccc(C)c2C)cc1Cl |
| InChI | InChI=1S/C16H15ClO/c1-10-5-4-6-14(11(10)2)13-7-8-15(12(3)18)16(17)9-13/h4-9H,1-3H3 |
| InChIKey | UQPDZKPREPLUAR-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |