5-(2,4-dichlorophenyl)-2-methylbenzoic acid

C14H10Cl2O2 — CID 65307021

IUPAC5-(2,4-dichlorophenyl)-2-methylbenzoic acid
SMILESCc1ccc(-c2ccc(Cl)cc2Cl)cc1C(=O)O
InChIInChI=1S/C14H10Cl2O2/c1-8-2-3-9(6-12(8)14(17)18)11-5-4-10(15)7-13(11)16/h2-7H,1H3,(H,17,18)
InChIKeyZTJBAOOJDVRIID-UHFFFAOYSA-N
MW281.14 g/mol
LogP4.67
Rot. Bonds2

About 5-(2,4-dichlorophenyl)-2-methylbenzoic acid

5-(2,4-dichlorophenyl)-2-methylbenzoic acid (PubChem CID 65307021) has the molecular formula C14H10Cl2O2 and a molecular weight of 281.14 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-2-methylbenzoic acid.

Molecular Properties

Compound Name5-(2,4-dichlorophenyl)-2-methylbenzoic acid
PubChem CID65307021
Molecular FormulaC14H10Cl2O2
Molecular Weight281.14 g/mol
Exact Mass280.01
IUPAC Name5-(2,4-dichlorophenyl)-2-methylbenzoic acid
SMILESCc1ccc(-c2ccc(Cl)cc2Cl)cc1C(=O)O
InChIInChI=1S/C14H10Cl2O2/c1-8-2-3-9(6-12(8)14(17)18)11-5-4-10(15)7-13(11)16/h2-7H,1H3,(H,17,18)
InChIKeyZTJBAOOJDVRIID-UHFFFAOYSA-N
XLogP4.67
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500281.14
LogP ≤ 54.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 5-(2,4-dichlorophenyl)-2-methylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2,4-dichlorophenyl)-2-methylbenzoic acid?
The IUPAC name of 5-(2,4-dichlorophenyl)-2-methylbenzoic acid (CID 65307021) is 5-(2,4-dichlorophenyl)-2-methylbenzoic acid.
What is the SMILES notation for 5-(2,4-dichlorophenyl)-2-methylbenzoic acid?
The canonical SMILES for 5-(2,4-dichlorophenyl)-2-methylbenzoic acid is Cc1ccc(-c2ccc(Cl)cc2Cl)cc1C(=O)O.
What is the InChIKey of 5-(2,4-dichlorophenyl)-2-methylbenzoic acid?
The InChIKey is ZTJBAOOJDVRIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2O2/c1-8-2-3-9(6-12(8)14(17)18)11-5-4-10(15)7-13(11)16/h2-7H,1H3,(H,17,18).
What are the key properties of 5-(2,4-dichlorophenyl)-2-methylbenzoic acid?
5-(2,4-dichlorophenyl)-2-methylbenzoic acid has a molecular weight of 281.14 g/mol, XLogP of 4.67, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2,4-dichlorophenyl)-2-methylbenzoic acid is sourced from PubChem (CID 65307021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).