4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid

C13H8Cl2O3 — CID 53227675

IUPAC4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid
SMILESO=C(O)c1ccc(-c2ccc(Cl)cc2Cl)cc1O
InChIInChI=1S/C13H8Cl2O3/c14-8-2-4-9(11(15)6-8)7-1-3-10(13(17)18)12(16)5-7/h1-6,16H,(H,17,18)
InChIKeyAHLFHEYHLNDDLJ-UHFFFAOYSA-N
MW283.11 g/mol
LogP4.06
Rot. Bonds2

About 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid

4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid (PubChem CID 53227675) has the molecular formula C13H8Cl2O3 and a molecular weight of 283.11 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid.

Molecular Properties

Compound Name4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid
PubChem CID53227675
Molecular FormulaC13H8Cl2O3
Molecular Weight283.11 g/mol
Exact Mass281.99
IUPAC Name4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid
SMILESO=C(O)c1ccc(-c2ccc(Cl)cc2Cl)cc1O
InChIInChI=1S/C13H8Cl2O3/c14-8-2-4-9(11(15)6-8)7-1-3-10(13(17)18)12(16)5-7/h1-6,16H,(H,17,18)
InChIKeyAHLFHEYHLNDDLJ-UHFFFAOYSA-N
XLogP4.06
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500283.11
LogP ≤ 54.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-(2,4-dichlorophenyl)-2-fluorobenzoic acid
CID 53211711
2,6-dichloro-4-(3,5-dichloro-4-hydroxyphenyl)phenol;5-(2,4-dichlorophenyl)-2-hydroxybenzoic acid
CID 143150419
5-(2,4-dichlorophenyl)-2-methylbenzoic acid
CID 65307021
5-chloro-2-(2,4-dichlorophenyl)benzoic acid
CID 114026411
1-[2-chloro-4-(2,4-dichlorophenyl)phenyl]ethanone
CID 82783018
4-(7-chloroquinolin-4-yl)-2-hydroxybenzoic acid
CID 167888725
5-(2,4-dichlorophenyl)-3-hydroxypyridine-2-carboxylic acid
CID 133093044
2-chloro-4-(2,5-dichlorophenyl)benzoic acid
CID 53227705
3-chloro-5-(2,4-dichlorophenyl)benzoic acid
CID 53227684
4-(3,4-difluorophenyl)-2-hydroxybenzoic acid
CID 53225879
4-chloro-2-(3-chloro-4-fluorophenyl)benzoic acid
CID 53226934
4-chloro-2-(3,4,5-trichlorophenyl)benzoic acid
CID 134629032

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid?
The IUPAC name of 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid (CID 53227675) is 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid?
The canonical SMILES for 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid is O=C(O)c1ccc(-c2ccc(Cl)cc2Cl)cc1O.
What is the InChIKey of 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid?
The InChIKey is AHLFHEYHLNDDLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8Cl2O3/c14-8-2-4-9(11(15)6-8)7-1-3-10(13(17)18)12(16)5-7/h1-6,16H,(H,17,18).
What are the key properties of 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid?
4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid has a molecular weight of 283.11 g/mol, XLogP of 4.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-2-hydroxybenzoic acid is sourced from PubChem (CID 53227675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).