C12H7Cl2NO3 — CID 133093044
5-(2,4-dichlorophenyl)-3-hydroxypyridine-2-carboxylic acid (PubChem CID 133093044) has the molecular formula C12H7Cl2NO3 and a molecular weight of 284.10 g/mol. Its IUPAC name is 5-(2,4-dichlorophenyl)-3-hydroxypyridine-2-carboxylic acid.
| Compound Name | 5-(2,4-dichlorophenyl)-3-hydroxypyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 133093044 |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 282.98 |
| IUPAC Name | 5-(2,4-dichlorophenyl)-3-hydroxypyridine-2-carboxylic acid |
| SMILES | O=C(O)c1ncc(-c2ccc(Cl)cc2Cl)cc1O |
| InChI | InChI=1S/C12H7Cl2NO3/c13-7-1-2-8(9(14)4-7)6-3-10(16)11(12(17)18)15-5-6/h1-5,16H,(H,17,18) |
| InChIKey | JLGYBMYGULAOMT-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 70.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |