C14H14ClNO4 — CID 142369382
5-(5-chloro-2-hydroxyphenyl)-3-hydroxypyridine-2-carboxylic acid;ethane (PubChem CID 142369382) has the molecular formula C14H14ClNO4 and a molecular weight of 295.72 g/mol. Its IUPAC name is 5-(5-chloro-2-hydroxyphenyl)-3-hydroxypyridine-2-carboxylic acid;ethane.
| Compound Name | 5-(5-chloro-2-hydroxyphenyl)-3-hydroxypyridine-2-carboxylic acid;ethane |
|---|---|
| PubChem CID | 142369382 |
| Molecular Formula | C14H14ClNO4 |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 5-(5-chloro-2-hydroxyphenyl)-3-hydroxypyridine-2-carboxylic acid;ethane |
| SMILES | CC.O=C(O)c1ncc(-c2cc(Cl)ccc2O)cc1O |
| InChI | InChI=1S/C12H8ClNO4.C2H6/c13-7-1-2-9(15)8(4-7)6-3-10(16)11(12(17)18)14-5-6;1-2/h1-5,15-16H,(H,17,18);1-2H3 |
| InChIKey | NHCKWEDCSKKYDJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |