C14H14ClN3O4 — CID 67212196
5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid;methylurea (PubChem CID 67212196) has the molecular formula C14H14ClN3O4 and a molecular weight of 323.74 g/mol. Its IUPAC name is 5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid;methylurea.
| Compound Name | 5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid;methylurea |
|---|---|
| PubChem CID | 67212196 |
| Molecular Formula | C14H14ClN3O4 |
| Molecular Weight | 323.74 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-(3-chlorophenyl)-3-hydroxypyridine-2-carboxylic acid;methylurea |
| SMILES | CNC(N)=O.O=C(O)c1ncc(-c2cccc(Cl)c2)cc1O |
| InChI | InChI=1S/C12H8ClNO3.C2H6N2O/c13-9-3-1-2-7(4-9)8-5-10(15)11(12(16)17)14-6-8;1-4-2(3)5/h1-6,15H,(H,16,17);1H3,(H3,3,4,5) |
| InChIKey | YFMCLSONLXEUSG-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |