C16H14ClNO3 — CID 148501489
1-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]pentane-1,4-dione (PubChem CID 148501489) has the molecular formula C16H14ClNO3 and a molecular weight of 303.75 g/mol. Its IUPAC name is 1-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]pentane-1,4-dione.
| Compound Name | 1-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]pentane-1,4-dione |
|---|---|
| PubChem CID | 148501489 |
| Molecular Formula | C16H14ClNO3 |
| Molecular Weight | 303.75 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]pentane-1,4-dione |
| SMILES | CC(=O)CCC(=O)c1ncc(-c2cccc(Cl)c2)cc1O |
| InChI | InChI=1S/C16H14ClNO3/c1-10(19)5-6-14(20)16-15(21)8-12(9-18-16)11-3-2-4-13(17)7-11/h2-4,7-9,21H,5-6H2,1H3 |
| InChIKey | MKSSCXOVYPDHAC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.75 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |