C16H13Cl2NO3 — CID 165046778
methyl 4-[3-chloro-5-(3-chlorophenyl)-2-pyridinyl]-4-oxobutanoate (PubChem CID 165046778) has the molecular formula C16H13Cl2NO3 and a molecular weight of 338.19 g/mol. Its IUPAC name is methyl 4-[3-chloro-5-(3-chlorophenyl)-2-pyridinyl]-4-oxobutanoate.
| Compound Name | methyl 4-[3-chloro-5-(3-chlorophenyl)-2-pyridinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 165046778 |
| Molecular Formula | C16H13Cl2NO3 |
| Molecular Weight | 338.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl 4-[3-chloro-5-(3-chlorophenyl)-2-pyridinyl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)c1ncc(-c2cccc(Cl)c2)cc1Cl |
| InChI | InChI=1S/C16H13Cl2NO3/c1-22-15(21)6-5-14(20)16-13(18)8-11(9-19-16)10-3-2-4-12(17)7-10/h2-4,7-9H,5-6H2,1H3 |
| InChIKey | VWMGAHFWWFMZNG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.19 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |