C38H40ClN3O18S2 — CID 162006009
methyl 4-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanoate;bis(methyl 4-(3-hydroxy-5-methylsulfonyloxy-2-pyridinyl)-4-oxobutanoate) (PubChem CID 162006009) has the molecular formula C38H40ClN3O18S2 and a molecular weight of 926.33 g/mol. Its IUPAC name is methyl 4-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanoate;bis(methyl 4-(3-hydroxy-5-methylsulfonyloxy-2-pyridinyl)-4-oxobutanoate).
| Compound Name | methyl 4-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanoate;bis(methyl 4-(3-hydroxy-5-methylsulfonyloxy-2-pyridinyl)-4-oxobutanoate) |
|---|---|
| PubChem CID | 162006009 |
| Molecular Formula | C38H40ClN3O18S2 |
| Molecular Weight | 926.33 g/mol |
| Exact Mass | 925.14 |
| IUPAC Name | methyl 4-[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]-4-oxobutanoate;bis(methyl 4-(3-hydroxy-5-methylsulfonyloxy-2-pyridinyl)-4-oxobutanoate) |
| SMILES | COC(=O)CCC(=O)c1ncc(-c2cccc(Cl)c2)cc1O.COC(=O)CCC(=O)c1ncc(OS(C)(=O)=O)cc1O.COC(=O)CCC(=O)c1ncc(OS(C)(=O)=O)cc1O |
| InChI | InChI=1S/C16H14ClNO4.2C11H13NO7S/c1-22-15(21)6-5-13(19)16-14(20)8-11(9-18-16)10-3-2-4-12(17)7-10;2*1-18-10(15)4-3-8(13)11-9(14)5-7(6-12-11)19-20(2,16)17/h2-4,7-9,20H,5-6H2,1H3;2*5-6,14H,3-4H2,1-2H3 |
| InChIKey | YSVPEYADQTWEOA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 316.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|