C15H13ClN2O4 — CID 142369403
methyl 2-[[5-(3-chlorophenyl)-6-deuterio-3-hydroxypyridine-2-carbonyl]amino]acetate (PubChem CID 142369403) has the molecular formula C15H13ClN2O4 and a molecular weight of 321.74 g/mol. Its IUPAC name is methyl 2-[[5-(3-chlorophenyl)-6-deuterio-3-hydroxypyridine-2-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[5-(3-chlorophenyl)-6-deuterio-3-hydroxypyridine-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 142369403 |
| Molecular Formula | C15H13ClN2O4 |
| Molecular Weight | 321.74 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | methyl 2-[[5-(3-chlorophenyl)-6-deuterio-3-hydroxypyridine-2-carbonyl]amino]acetate |
| SMILES | [2H]c1nc(C(=O)NCC(=O)OC)c(O)cc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H13ClN2O4/c1-22-13(20)8-18-15(21)14-12(19)6-10(7-17-14)9-3-2-4-11(16)5-9/h2-7,19H,8H2,1H3,(H,18,21)/i7D |
| InChIKey | LQWXMRRGVHUWEN-WHRKIXHSSA-N |
| XLogP | 2.01 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.74 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |