methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate

C10H11NO5 — CID 103890198

IUPACmethyl 2-[(2,6-dihydroxybenzoyl)amino]acetate
SMILESCOC(=O)CNC(=O)c1c(O)cccc1O
InChIInChI=1S/C10H11NO5/c1-16-8(14)5-11-10(15)9-6(12)3-2-4-7(9)13/h2-4,12-13H,5H2,1H3,(H,11,15)
InChIKeyYHYLHQBRGWVTIN-UHFFFAOYSA-N
MW225.20 g/mol
LogP0.00
Rot. Bonds3

About methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate

methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate (PubChem CID 103890198) has the molecular formula C10H11NO5 and a molecular weight of 225.20 g/mol. Its IUPAC name is methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate.

Molecular Properties

Compound Namemethyl 2-[(2,6-dihydroxybenzoyl)amino]acetate
PubChem CID103890198
Molecular FormulaC10H11NO5
Molecular Weight225.20 g/mol
Exact Mass225.06
IUPAC Namemethyl 2-[(2,6-dihydroxybenzoyl)amino]acetate
SMILESCOC(=O)CNC(=O)c1c(O)cccc1O
InChIInChI=1S/C10H11NO5/c1-16-8(14)5-11-10(15)9-6(12)3-2-4-7(9)13/h2-4,12-13H,5H2,1H3,(H,11,15)
InChIKeyYHYLHQBRGWVTIN-UHFFFAOYSA-N
XLogP0.00
TPSA95.86 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500225.20
LogP ≤ 50.00
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Analyze methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate?
The IUPAC name of methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate (CID 103890198) is methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate.
What is the SMILES notation for methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate?
The canonical SMILES for methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate is COC(=O)CNC(=O)c1c(O)cccc1O.
What is the InChIKey of methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate?
The InChIKey is YHYLHQBRGWVTIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO5/c1-16-8(14)5-11-10(15)9-6(12)3-2-4-7(9)13/h2-4,12-13H,5H2,1H3,(H,11,15).
What are the key properties of methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate?
methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate has a molecular weight of 225.20 g/mol, XLogP of 0.00, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2,6-dihydroxybenzoyl)amino]acetate is sourced from PubChem (CID 103890198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).